C22H20F2N2O6 — CID 102136981
diethyl 2-[(1R,2R)-2-cyano-1-(2,6-difluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate (PubChem CID 102136981) has the molecular formula C22H20F2N2O6 and a molecular weight of 446.41 g/mol. Its IUPAC name is diethyl 2-[(1R,2R)-2-cyano-1-(2,6-difluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2R)-2-cyano-1-(2,6-difluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 102136981 |
| Molecular Formula | C22H20F2N2O6 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | diethyl 2-[(1R,2R)-2-cyano-1-(2,6-difluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](c1c(F)cccc1F)[C@@H](C#N)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20F2N2O6/c1-3-31-21(27)20(22(28)32-4-2)18(19-16(23)6-5-7-17(19)24)15(12-25)13-8-10-14(11-9-13)26(29)30/h5-11,15,18,20H,3-4H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | CVYDELYDLUOAFR-YJBOKZPZSA-N |
| XLogP | 4.01 |
| TPSA | 119.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|