C20H17ClN2O2 — CID 102137047
1'-chloro-3'-[(4-ethenylphenyl)methyl]spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione (PubChem CID 102137047) has the molecular formula C20H17ClN2O2 and a molecular weight of 352.82 g/mol. Its IUPAC name is 1'-chloro-3'-[(4-ethenylphenyl)methyl]spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | 1'-chloro-3'-[(4-ethenylphenyl)methyl]spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 102137047 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1'-chloro-3'-[(4-ethenylphenyl)methyl]spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
| SMILES | C=Cc1ccc(CN2C(=O)N(Cl)C3(Cc4ccccc4C3)C2=O)cc1 |
| InChI | InChI=1S/C20H17ClN2O2/c1-2-14-7-9-15(10-8-14)13-22-18(24)20(23(21)19(22)25)11-16-5-3-4-6-17(16)12-20/h2-10H,1,11-13H2 |
| InChIKey | FYDWEYCGYMLRCC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|