C15H25NO3 — CID 102137326
(Z)-N-[(2S,3E,5E)-7-hydroxy-4,6-dimethylhepta-3,5-dien-2-yl]-2-methoxypent-2-enamide (PubChem CID 102137326) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (Z)-N-[(2S,3E,5E)-7-hydroxy-4,6-dimethylhepta-3,5-dien-2-yl]-2-methoxypent-2-enamide.
| Compound Name | (Z)-N-[(2S,3E,5E)-7-hydroxy-4,6-dimethylhepta-3,5-dien-2-yl]-2-methoxypent-2-enamide |
|---|---|
| PubChem CID | 102137326 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (Z)-N-[(2S,3E,5E)-7-hydroxy-4,6-dimethylhepta-3,5-dien-2-yl]-2-methoxypent-2-enamide |
| SMILES | CC/C=C(\OC)C(=O)N[C@@H](C)/C=C(C)/C=C(\C)CO |
| InChI | InChI=1S/C15H25NO3/c1-6-7-14(19-5)15(18)16-13(4)9-11(2)8-12(3)10-17/h7-9,13,17H,6,10H2,1-5H3,(H,16,18)/b11-9+,12-8+,14-7-/t13-/m0/s1 |
| InChIKey | BAYXAEOMTFFZTH-JBHMXDMMSA-N |
| XLogP | 2.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|