C21H30O4 — CID 102137513
(1R,3S,8R,10S,12R,13S)-12-[(1E,3E)-hepta-1,3,6-trienyl]-3,13-dimethyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-14-en-13-ol (PubChem CID 102137513) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1R,3S,8R,10S,12R,13S)-12-[(1E,3E)-hepta-1,3,6-trienyl]-3,13-dimethyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-14-en-13-ol.
| Compound Name | (1R,3S,8R,10S,12R,13S)-12-[(1E,3E)-hepta-1,3,6-trienyl]-3,13-dimethyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-14-en-13-ol |
|---|---|
| PubChem CID | 102137513 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (1R,3S,8R,10S,12R,13S)-12-[(1E,3E)-hepta-1,3,6-trienyl]-3,13-dimethyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-14-en-13-ol |
| SMILES | C=CC/C=C/C=C/[C@H]1O[C@H]2C[C@H]3OCCC[C@]3(C)O[C@@H]2C=C[C@]1(C)O |
| InChI | InChI=1S/C21H30O4/c1-4-5-6-7-8-10-18-20(2,22)13-11-16-17(24-18)15-19-21(3,25-16)12-9-14-23-19/h4,6-8,10-11,13,16-19,22H,1,5,9,12,14-15H2,2-3H3/b7-6+,10-8+/t16-,17+,18-,19-,20+,21+/m1/s1 |
| InChIKey | LJHZFZQOYGBHKD-MRRSGALLSA-N |
| XLogP | 3.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|