C15H16O5 — CID 102137537
dimethyl 4-methylidene-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate (PubChem CID 102137537) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is dimethyl 4-methylidene-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate.
| Compound Name | dimethyl 4-methylidene-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102137537 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | dimethyl 4-methylidene-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)CC12C=CC(=O)C=C2 |
| InChI | InChI=1S/C15H16O5/c1-10-8-15(12(17)19-2,13(18)20-3)9-14(10)6-4-11(16)5-7-14/h4-7H,1,8-9H2,2-3H3 |
| InChIKey | RKOLGZBASFLBCS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|