C40H24N2O4 — CID 102137846
5-[4-[4-[4-[4-(1,3-dioxoisoindol-5-yl)phenyl]phenyl]phenyl]phenyl]isoindole-1,3-dione (PubChem CID 102137846) has the molecular formula C40H24N2O4 and a molecular weight of 596.64 g/mol. Its IUPAC name is 5-[4-[4-[4-[4-(1,3-dioxoisoindol-5-yl)phenyl]phenyl]phenyl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-[4-[4-[4-[4-(1,3-dioxoisoindol-5-yl)phenyl]phenyl]phenyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102137846 |
| Molecular Formula | C40H24N2O4 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 5-[4-[4-[4-[4-(1,3-dioxoisoindol-5-yl)phenyl]phenyl]phenyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(-c7ccc8c(c7)C(=O)NC8=O)cc6)cc5)cc4)cc3)ccc21 |
| InChI | InChI=1S/C40H24N2O4/c43-37-33-19-17-31(21-35(33)39(45)41-37)29-13-9-27(10-14-29)25-5-1-23(2-6-25)24-3-7-26(8-4-24)28-11-15-30(16-12-28)32-18-20-34-36(22-32)40(46)42-38(34)44/h1-22H,(H,41,43,45)(H,42,44,46) |
| InChIKey | GVYAPNYMAJLSGA-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|