C20H35NO3 — CID 102137892
[1-oxo-1-(pentylamino)dodec-11-en-2-yl] prop-2-enoate (PubChem CID 102137892) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is [1-oxo-1-(pentylamino)dodec-11-en-2-yl] prop-2-enoate.
| Compound Name | [1-oxo-1-(pentylamino)dodec-11-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 102137892 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | [1-oxo-1-(pentylamino)dodec-11-en-2-yl] prop-2-enoate |
| SMILES | C=CCCCCCCCCC(OC(=O)C=C)C(=O)NCCCCC |
| InChI | InChI=1S/C20H35NO3/c1-4-7-9-10-11-12-13-14-16-18(24-19(22)6-3)20(23)21-17-15-8-5-2/h4,6,18H,1,3,5,7-17H2,2H3,(H,21,23) |
| InChIKey | SMJXZSMLNYIEFO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|