C21H35NO5 — CID 102137894
[1-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-1-oxododec-11-en-2-yl] prop-2-enoate (PubChem CID 102137894) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is [1-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-1-oxododec-11-en-2-yl] prop-2-enoate.
| Compound Name | [1-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-1-oxododec-11-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 102137894 |
| Molecular Formula | C21H35NO5 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | [1-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-1-oxododec-11-en-2-yl] prop-2-enoate |
| SMILES | C=CCCCCCCCCC(OC(=O)C=C)C(=O)NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35NO5/c1-6-8-9-10-11-12-13-14-15-17(26-18(23)7-2)20(25)22-16-19(24)27-21(3,4)5/h6-7,17H,1-2,8-16H2,3-5H3,(H,22,25) |
| InChIKey | ZCXZCQVERGQZOT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|