C22H44Si4 — CID 102138044
trimethyl-[(1E,5E)-6-trimethylsilyl-3,4-bis[(E)-2-trimethylsilylethenyl]hexa-1,3,5-trienyl]silane (PubChem CID 102138044) has the molecular formula C22H44Si4 and a molecular weight of 420.94 g/mol. Its IUPAC name is trimethyl-[(1E,5E)-6-trimethylsilyl-3,4-bis[(E)-2-trimethylsilylethenyl]hexa-1,3,5-trienyl]silane.
| Compound Name | trimethyl-[(1E,5E)-6-trimethylsilyl-3,4-bis[(E)-2-trimethylsilylethenyl]hexa-1,3,5-trienyl]silane |
|---|---|
| PubChem CID | 102138044 |
| Molecular Formula | C22H44Si4 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | trimethyl-[(1E,5E)-6-trimethylsilyl-3,4-bis[(E)-2-trimethylsilylethenyl]hexa-1,3,5-trienyl]silane |
| SMILES | C[Si](C)(C)/C=C/C(/C=C/[Si](C)(C)C)=C(/C=C/[Si](C)(C)C)/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C22H44Si4/c1-23(2,3)17-13-21(14-18-24(4,5)6)22(15-19-25(7,8)9)16-20-26(10,11)12/h13-20H,1-12H3/b17-13+,18-14+,19-15+,20-16+ |
| InChIKey | YXUUMMZSFPDOHL-AQWWNALJSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|