About (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole
(2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole (PubChem CID 102138912) has the molecular formula C16H16BrN
and a molecular weight of 302.22 g/mol. Its IUPAC name is (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole |
| PubChem CID | 102138912 |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole |
| SMILES | C[C@H]1Nc2ccccc2[C@H]1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16BrN/c1-11-15(10-12-6-8-13(17)9-7-12)14-4-2-3-5-16(14)18-11/h2-9,11,15,18H,10H2,1H3/t11-,15+/m1/s1 |
| InChIKey | SHLJQNVLLCMJND-ABAIWWIYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole?
The IUPAC name of (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole (CID 102138912) is (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole.
What is the SMILES notation for (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole?
The canonical SMILES for (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole is C[C@H]1Nc2ccccc2[C@H]1Cc1ccc(Br)cc1.
What is the InChIKey of (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole?
The InChIKey is SHLJQNVLLCMJND-ABAIWWIYSA-N. The full InChI is InChI=1S/C16H16BrN/c1-11-15(10-12-6-8-13(17)9-7-12)14-4-2-3-5-16(14)18-11/h2-9,11,15,18H,10H2,1H3/t11-,15+/m1/s1.
What are the key properties of (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole?
(2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole has a molecular weight of 302.22 g/mol, XLogP of 4.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-[(4-bromophenyl)methyl]-2-methyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 102138912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).