C22H35NO2 — CID 102139399
(4Z,7Z,10Z,13Z,16Z)-N-(2-hydroxyethyl)icosa-4,7,10,13,16-pentaenamide (PubChem CID 102139399) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z)-N-(2-hydroxyethyl)icosa-4,7,10,13,16-pentaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z)-N-(2-hydroxyethyl)icosa-4,7,10,13,16-pentaenamide |
|---|---|
| PubChem CID | 102139399 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z)-N-(2-hydroxyethyl)icosa-4,7,10,13,16-pentaenamide |
| SMILES | CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCO |
| InChI | InChI=1S/C22H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h4-5,7-8,10-11,13-14,16-17,24H,2-3,6,9,12,15,18-21H2,1H3,(H,23,25)/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | WXLVTVRMTDZIMJ-JEBPEJKESA-N |
| XLogP | 5.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|