C32H19F17N2O2 — CID 102139549
(4S)-2-[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 102139549) has the molecular formula C32H19F17N2O2 and a molecular weight of 786.48 g/mol. Its IUPAC name is (4S)-2-[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102139549 |
| Molecular Formula | C32H19F17N2O2 |
| Molecular Weight | 786.48 g/mol |
| Exact Mass | 786.12 |
| IUPAC Name | (4S)-2-[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1cc(C2=N[C@@H](c3ccccc3)CO2)cc(C2=N[C@@H](c3ccccc3)CO2)c1 |
| InChI | InChI=1S/C32H19F17N2O2/c33-25(34,26(35,36)27(37,38)28(39,40)29(41,42)30(43,44)31(45,46)32(47,48)49)20-12-18(23-50-21(14-52-23)16-7-3-1-4-8-16)11-19(13-20)24-51-22(15-53-24)17-9-5-2-6-10-17/h1-13,21-22H,14-15H2/t21-,22-/m1/s1 |
| InChIKey | GQUUHMXJEHNBQV-FGZHOGPDSA-N |
| XLogP | 10.19 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.48 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|