5-(3-carboxyphenyl)-2-hydroxybenzoic acid

C14H10O5 — CID 102139788

IUPAC5-(3-carboxyphenyl)-2-hydroxybenzoic acid
SMILESO=C(O)c1cccc(-c2ccc(O)c(C(=O)O)c2)c1
InChIInChI=1S/C14H10O5/c15-12-5-4-9(7-11(12)14(18)19)8-2-1-3-10(6-8)13(16)17/h1-7,15H,(H,16,17)(H,18,19)
InChIKeyHMRSLIVDTRSOBX-UHFFFAOYSA-N
MW258.23 g/mol
LogP2.46
Rot. Bonds3

About 5-(3-carboxyphenyl)-2-hydroxybenzoic acid

5-(3-carboxyphenyl)-2-hydroxybenzoic acid (PubChem CID 102139788) has the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is 5-(3-carboxyphenyl)-2-hydroxybenzoic acid.

Molecular Properties

Compound Name5-(3-carboxyphenyl)-2-hydroxybenzoic acid
PubChem CID102139788
Molecular FormulaC14H10O5
Molecular Weight258.23 g/mol
Exact Mass258.05
IUPAC Name5-(3-carboxyphenyl)-2-hydroxybenzoic acid
SMILESO=C(O)c1cccc(-c2ccc(O)c(C(=O)O)c2)c1
InChIInChI=1S/C14H10O5/c15-12-5-4-9(7-11(12)14(18)19)8-2-1-3-10(6-8)13(16)17/h1-7,15H,(H,16,17)(H,18,19)
InChIKeyHMRSLIVDTRSOBX-UHFFFAOYSA-N
XLogP2.46
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.23
LogP ≤ 52.46
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 5-(3-carboxyphenyl)-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-(3-tert-butylphenyl)-2-hydroxybenzoic acid
CID 67567702
3-[3-(3-carboxyphenyl)phenyl]benzoic acid
CID 12023925
3-(4-carboxyphenyl)benzoic acid
CID 11550488
4-hydroxybenzene-1,3-dicarboxylic acid
CID 161113247
3-phenylbenzoic acid;4-phenylbenzoic acid
CID 161256783
2-hydroxy-5-(3-methoxyphenyl)benzoic acid
CID 4564140
5-(3-acetamidophenyl)-2-hydroxybenzoic acid
CID 10978560
3-(4-carboxyphenyl)benzoic acid;ethane
CID 144908404
3-(4-chlorophenyl)benzoic acid
CID 2757419
3-(2-hydroxyphenyl)benzoic acid;hydrochloride
CID 174448662
5-(3-carbamoylphenyl)-2-chlorobenzoic acid
CID 53226144
3-[2-hydroxy-6-(3-hydroxyphenyl)naphthalen-1-yl]benzoic acid
CID 25069442

Frequently Asked Questions

What is the IUPAC name of 5-(3-carboxyphenyl)-2-hydroxybenzoic acid?
The IUPAC name of 5-(3-carboxyphenyl)-2-hydroxybenzoic acid (CID 102139788) is 5-(3-carboxyphenyl)-2-hydroxybenzoic acid.
What is the SMILES notation for 5-(3-carboxyphenyl)-2-hydroxybenzoic acid?
The canonical SMILES for 5-(3-carboxyphenyl)-2-hydroxybenzoic acid is O=C(O)c1cccc(-c2ccc(O)c(C(=O)O)c2)c1.
What is the InChIKey of 5-(3-carboxyphenyl)-2-hydroxybenzoic acid?
The InChIKey is HMRSLIVDTRSOBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O5/c15-12-5-4-9(7-11(12)14(18)19)8-2-1-3-10(6-8)13(16)17/h1-7,15H,(H,16,17)(H,18,19).
What are the key properties of 5-(3-carboxyphenyl)-2-hydroxybenzoic acid?
5-(3-carboxyphenyl)-2-hydroxybenzoic acid has a molecular weight of 258.23 g/mol, XLogP of 2.46, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-carboxyphenyl)-2-hydroxybenzoic acid is sourced from PubChem (CID 102139788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).