About [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol
[(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol (PubChem CID 102140405) has the molecular formula C9H10ClNO
and a molecular weight of 183.64 g/mol. Its IUPAC name is [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol.
Molecular Properties
| Compound Name | [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol |
| PubChem CID | 102140405 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol |
| SMILES | OC[C@H]1CCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C9H10ClNO/c10-8-4-3-6-1-2-7(5-12)9(6)11-8/h3-4,7,12H,1-2,5H2/t7-/m1/s1 |
| InChIKey | PNGARBZHLZASCT-SSDOTTSWSA-N |
| XLogP | 1.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol?
The IUPAC name of [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol (CID 102140405) is [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol.
What is the SMILES notation for [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol?
The canonical SMILES for [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol is OC[C@H]1CCc2ccc(Cl)nc21.
What is the InChIKey of [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol?
The InChIKey is PNGARBZHLZASCT-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H10ClNO/c10-8-4-3-6-1-2-7(5-12)9(6)11-8/h3-4,7,12H,1-2,5H2/t7-/m1/s1.
What are the key properties of [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol?
[(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol has a molecular weight of 183.64 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol is sourced from PubChem (CID 102140405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).