C9H10ClNO — CID 102140405
[(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol (PubChem CID 102140405) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol.
| Compound Name | [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 102140405 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | [(7S)-2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]methanol |
| SMILES | OC[C@H]1CCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C9H10ClNO/c10-8-4-3-6-1-2-7(5-12)9(6)11-8/h3-4,7,12H,1-2,5H2/t7-/m1/s1 |
| InChIKey | PNGARBZHLZASCT-SSDOTTSWSA-N |
| XLogP | 1.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|