C22H22F3IO3 — CID 102140558
4-(3-iodo-4,4-diphenylbut-3-enoxy)butyl 2,2,2-trifluoroacetate (PubChem CID 102140558) has the molecular formula C22H22F3IO3 and a molecular weight of 518.31 g/mol. Its IUPAC name is 4-(3-iodo-4,4-diphenylbut-3-enoxy)butyl 2,2,2-trifluoroacetate.
| Compound Name | 4-(3-iodo-4,4-diphenylbut-3-enoxy)butyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 102140558 |
| Molecular Formula | C22H22F3IO3 |
| Molecular Weight | 518.31 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | 4-(3-iodo-4,4-diphenylbut-3-enoxy)butyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCCCCOCCC(I)=C(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H22F3IO3/c23-22(24,25)21(27)29-15-8-7-14-28-16-13-19(26)20(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2 |
| InChIKey | RZPFFXPFFGGEFD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.31 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|