C24H26BrF3O3 — CID 102140565
4-[3-bromo-4,4-bis(4-methylphenyl)but-3-enoxy]butyl 2,2,2-trifluoroacetate (PubChem CID 102140565) has the molecular formula C24H26BrF3O3 and a molecular weight of 499.37 g/mol. Its IUPAC name is 4-[3-bromo-4,4-bis(4-methylphenyl)but-3-enoxy]butyl 2,2,2-trifluoroacetate.
| Compound Name | 4-[3-bromo-4,4-bis(4-methylphenyl)but-3-enoxy]butyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 102140565 |
| Molecular Formula | C24H26BrF3O3 |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 4-[3-bromo-4,4-bis(4-methylphenyl)but-3-enoxy]butyl 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(=C(Br)CCOCCCCOC(=O)C(F)(F)F)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H26BrF3O3/c1-17-5-9-19(10-6-17)22(20-11-7-18(2)8-12-20)21(25)13-16-30-14-3-4-15-31-23(29)24(26,27)28/h5-12H,3-4,13-16H2,1-2H3 |
| InChIKey | RCDWISBYJXUUJC-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|