C24H47BO5Si — CID 102140932
[(Z)-1-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-5-en-4-yl] acetate (PubChem CID 102140932) has the molecular formula C24H47BO5Si and a molecular weight of 454.53 g/mol. Its IUPAC name is [(Z)-1-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-5-en-4-yl] acetate.
| Compound Name | [(Z)-1-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-5-en-4-yl] acetate |
|---|---|
| PubChem CID | 102140932 |
| Molecular Formula | C24H47BO5Si |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | [(Z)-1-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-5-en-4-yl] acetate |
| SMILES | CCCC/C(=C\C(CCCO[Si](C)(C)C(C)(C)C)OC(C)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H47BO5Si/c1-12-13-15-20(25-29-23(6,7)24(8,9)30-25)18-21(28-19(2)26)16-14-17-27-31(10,11)22(3,4)5/h18,21H,12-17H2,1-11H3/b20-18+ |
| InChIKey | ITWMSQVCBQXGBH-CZIZESTLSA-N |
| XLogP | 6.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|