C15H31IO3Si — CID 102141087
(E,2S,3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodo-4,6-dimethylhept-6-ene-2,3-diol (PubChem CID 102141087) has the molecular formula C15H31IO3Si and a molecular weight of 414.40 g/mol. Its IUPAC name is (E,2S,3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodo-4,6-dimethylhept-6-ene-2,3-diol.
| Compound Name | (E,2S,3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodo-4,6-dimethylhept-6-ene-2,3-diol |
|---|---|
| PubChem CID | 102141087 |
| Molecular Formula | C15H31IO3Si |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (E,2S,3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodo-4,6-dimethylhept-6-ene-2,3-diol |
| SMILES | C/C(=C\I)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C15H31IO3Si/c1-10(9-16)14(11(2)13(18)12(3)17)19-20(7,8)15(4,5)6/h9,11-14,17-18H,1-8H3/b10-9+/t11-,12-,13+,14+/m0/s1 |
| InChIKey | QJOVXXPUGMQTEF-UTBLTCPOSA-N |
| XLogP | 4.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|