C8H8BrF5O2 — CID 102141511
(Z)-2-(bromomethyl)-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one (PubChem CID 102141511) has the molecular formula C8H8BrF5O2 and a molecular weight of 311.04 g/mol. Its IUPAC name is (Z)-2-(bromomethyl)-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one.
| Compound Name | (Z)-2-(bromomethyl)-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one |
|---|---|
| PubChem CID | 102141511 |
| Molecular Formula | C8H8BrF5O2 |
| Molecular Weight | 311.04 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | (Z)-2-(bromomethyl)-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one |
| SMILES | CCO/C=C(\CBr)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8BrF5O2/c1-2-16-4-5(3-9)6(15)7(10,11)8(12,13)14/h4H,2-3H2,1H3/b5-4+ |
| InChIKey | XKRCWLANVJTRRL-SNAWJCMRSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.04 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|