C9H8BrF7O2 — CID 102141512
(Z)-2-(bromomethyl)-1-ethoxy-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one (PubChem CID 102141512) has the molecular formula C9H8BrF7O2 and a molecular weight of 361.05 g/mol. Its IUPAC name is (Z)-2-(bromomethyl)-1-ethoxy-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one.
| Compound Name | (Z)-2-(bromomethyl)-1-ethoxy-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one |
|---|---|
| PubChem CID | 102141512 |
| Molecular Formula | C9H8BrF7O2 |
| Molecular Weight | 361.05 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | (Z)-2-(bromomethyl)-1-ethoxy-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one |
| SMILES | CCO/C=C(\CBr)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8BrF7O2/c1-2-19-4-5(3-10)6(18)7(11,12)8(13,14)9(15,16)17/h4H,2-3H2,1H3/b5-4+ |
| InChIKey | LDQXHGBXUQNQTG-SNAWJCMRSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.05 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|