About (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one
(Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one (PubChem CID 102141513) has the molecular formula C7H9BrF2O2
and a molecular weight of 243.05 g/mol. Its IUPAC name is (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one.
Molecular Properties
| Compound Name | (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one |
| PubChem CID | 102141513 |
| Molecular Formula | C7H9BrF2O2 |
| Molecular Weight | 243.05 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one |
| SMILES | CCO/C=C(\CBr)C(=O)C(F)F |
| InChI | InChI=1S/C7H9BrF2O2/c1-2-12-4-5(3-8)6(11)7(9)10/h4,7H,2-3H2,1H3/b5-4+ |
| InChIKey | OCBJHDGHGAUUBQ-SNAWJCMRSA-N |
| XLogP | 2.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.05 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one?
The IUPAC name of (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one (CID 102141513) is (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one.
What is the SMILES notation for (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one?
The canonical SMILES for (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one is CCO/C=C(\CBr)C(=O)C(F)F.
What is the InChIKey of (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one?
The InChIKey is OCBJHDGHGAUUBQ-SNAWJCMRSA-N. The full InChI is InChI=1S/C7H9BrF2O2/c1-2-12-4-5(3-8)6(11)7(9)10/h4,7H,2-3H2,1H3/b5-4+.
What are the key properties of (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one?
(Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one has a molecular weight of 243.05 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(bromomethyl)-4-ethoxy-1,1-difluorobut-3-en-2-one is sourced from PubChem (CID 102141513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).