C28H41NO4 — CID 102141602
trans-(11R,15R)-13-(3,3-dimethylbutan-2-yl)-11,15-diphenyl-1,4,7,10-tetraoxa-13-azacyclopentadecane (PubChem CID 102141602) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is trans-(11R,15R)-13-(3,3-dimethylbutan-2-yl)-11,15-diphenyl-1,4,7,10-tetraoxa-13-azacyclopentadecane.
| Compound Name | trans-(11R,15R)-13-(3,3-dimethylbutan-2-yl)-11,15-diphenyl-1,4,7,10-tetraoxa-13-azacyclopentadecane |
|---|---|
| PubChem CID | 102141602 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | trans-(11R,15R)-13-(3,3-dimethylbutan-2-yl)-11,15-diphenyl-1,4,7,10-tetraoxa-13-azacyclopentadecane |
| SMILES | CC(N1C[C@@H](c2ccccc2)OCCOCCOCCO[C@H](c2ccccc2)C1)C(C)(C)C |
| InChI | InChI=1S/C28H41NO4/c1-23(28(2,3)4)29-21-26(24-11-7-5-8-12-24)32-19-17-30-15-16-31-18-20-33-27(22-29)25-13-9-6-10-14-25/h5-14,23,26-27H,15-22H2,1-4H3/t23?,26-,27-/m0/s1 |
| InChIKey | ZQCQZYCORFRFBS-ZROWWJAZSA-N |
| XLogP | 5.29 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |