C38H37BF2N4O2 — CID 102142006
4-[4,12-bis[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,2-difluoro-6,10-dimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoic acid (PubChem CID 102142006) has the molecular formula C38H37BF2N4O2 and a molecular weight of 630.55 g/mol. Its IUPAC name is 4-[4,12-bis[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,2-difluoro-6,10-dimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoic acid.
| Compound Name | 4-[4,12-bis[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,2-difluoro-6,10-dimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoic acid |
|---|---|
| PubChem CID | 102142006 |
| Molecular Formula | C38H37BF2N4O2 |
| Molecular Weight | 630.55 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 4-[4,12-bis[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,2-difluoro-6,10-dimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoic acid |
| SMILES | CC1=CC(/C=C/c2ccc(N(C)C)cc2)=[N+]2C1=C(c1ccc(C(=O)O)cc1)c1c(C)cc(/C=C/c3ccc(N(C)C)cc3)n1[B-]2(F)F |
| InChI | InChI=1S/C38H37BF2N4O2/c1-25-23-33(21-11-27-7-17-31(18-8-27)42(3)4)44-36(25)35(29-13-15-30(16-14-29)38(46)47)37-26(2)24-34(45(37)39(44,40)41)22-12-28-9-19-32(20-10-28)43(5)6/h7-24H,1-6H3,(H,46,47)/b21-11+,22-12+ |
| InChIKey | JELMJVVRQVPIAM-XHQRYOPUSA-N |
| XLogP | 7.92 |
| TPSA | 51.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.55 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|