C31H29N3O4 — CID 102142333
14-[4-(3-aminopropylamino)butyl]-5,23-dihydroxy-14-azahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3(8),4,6,9,12(16),18,20(25),21,23-undecaene-13,15-dione (PubChem CID 102142333) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is 14-[4-(3-aminopropylamino)butyl]-5,23-dihydroxy-14-azahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3(8),4,6,9,12(16),18,20(25),21,23-undecaene-13,15-dione.
| Compound Name | 14-[4-(3-aminopropylamino)butyl]-5,23-dihydroxy-14-azahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3(8),4,6,9,12(16),18,20(25),21,23-undecaene-13,15-dione |
|---|---|
| PubChem CID | 102142333 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 14-[4-(3-aminopropylamino)butyl]-5,23-dihydroxy-14-azahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3(8),4,6,9,12(16),18,20(25),21,23-undecaene-13,15-dione |
| SMILES | NCCCNCCCCN1C(=O)c2c(c3ccc4ccc(O)cc4c3c3c2ccc2ccc(O)cc23)C1=O |
| InChI | InChI=1S/C31H29N3O4/c32-12-3-14-33-13-1-2-15-34-30(37)28-22-10-6-18-4-8-20(35)16-24(18)26(22)27-23(29(28)31(34)38)11-7-19-5-9-21(36)17-25(19)27/h4-11,16-17,33,35-36H,1-3,12-15,32H2 |
| InChIKey | KDSHDLDVXJJCCR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|