C18H38O2Si — CID 102142958
tert-butyl-[(4S,5R,6R,7S)-6-methoxy-5,7-dimethylnon-1-en-4-yl]oxy-dimethylsilane (PubChem CID 102142958) has the molecular formula C18H38O2Si and a molecular weight of 314.59 g/mol. Its IUPAC name is tert-butyl-[(4S,5R,6R,7S)-6-methoxy-5,7-dimethylnon-1-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,5R,6R,7S)-6-methoxy-5,7-dimethylnon-1-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102142958 |
| Molecular Formula | C18H38O2Si |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | tert-butyl-[(4S,5R,6R,7S)-6-methoxy-5,7-dimethylnon-1-en-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OC)[C@@H](C)CC |
| InChI | InChI=1S/C18H38O2Si/c1-11-13-16(20-21(9,10)18(5,6)7)15(4)17(19-8)14(3)12-2/h11,14-17H,1,12-13H2,2-10H3/t14-,15-,16-,17+/m0/s1 |
| InChIKey | BSJSMMHVSOTMMR-LUKYLMHMSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|