About 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one
8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one (PubChem CID 102143353) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one.
Molecular Properties
| Compound Name | 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one |
| PubChem CID | 102143353 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one |
| SMILES | CCOC1CC2(C)OC1C1OC1C2=O |
| InChI | InChI=1S/C10H14O4/c1-3-12-5-4-10(2)9(11)8-7(13-8)6(5)14-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | RIHLHQGJDQEKON-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one?
The IUPAC name of 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one (CID 102143353) is 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one.
What is the SMILES notation for 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one?
The canonical SMILES for 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one is CCOC1CC2(C)OC1C1OC1C2=O.
What is the InChIKey of 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one?
The InChIKey is RIHLHQGJDQEKON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-3-12-5-4-10(2)9(11)8-7(13-8)6(5)14-10/h5-8H,3-4H2,1-2H3.
What are the key properties of 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one?
8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one has a molecular weight of 198.22 g/mol, XLogP of 0.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethoxy-6-methyl-3,9-dioxatricyclo[4.2.1.02,4]nonan-5-one is sourced from PubChem (CID 102143353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).