C12H24O2 — CID 102143435
(Z)-2,2,7,7-tetramethyloct-4-ene-1,8-diol (PubChem CID 102143435) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (Z)-2,2,7,7-tetramethyloct-4-ene-1,8-diol.
| Compound Name | (Z)-2,2,7,7-tetramethyloct-4-ene-1,8-diol |
|---|---|
| PubChem CID | 102143435 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (Z)-2,2,7,7-tetramethyloct-4-ene-1,8-diol |
| SMILES | CC(C)(CO)C/C=C\CC(C)(C)CO |
| InChI | InChI=1S/C12H24O2/c1-11(2,9-13)7-5-6-8-12(3,4)10-14/h5-6,13-14H,7-10H2,1-4H3/b6-5- |
| InChIKey | MPWGQTVZQVPOKX-WAYWQWQTSA-N |
| XLogP | 2.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|