C22H26N2O6 — CID 102143447
1-[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-(2-hydroxyphenyl)-2-(2-nitrophenyl)ethanone (PubChem CID 102143447) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-(2-hydroxyphenyl)-2-(2-nitrophenyl)ethanone.
| Compound Name | 1-[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-(2-hydroxyphenyl)-2-(2-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 102143447 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-(2-hydroxyphenyl)-2-(2-nitrophenyl)ethanone |
| SMILES | COC[C@@H]1CC[C@@H](COC)N1C(=O)C(c1ccccc1O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N2O6/c1-29-13-15-11-12-16(14-30-2)23(15)22(26)21(18-8-4-6-10-20(18)25)17-7-3-5-9-19(17)24(27)28/h3-10,15-16,21,25H,11-14H2,1-2H3/t15-,16-,21?/m0/s1 |
| InChIKey | KVEDDOVLVGTPKD-MBFMUOJQSA-N |
| XLogP | 3.08 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|