C26H26N2O — CID 102143729
14-(4-tert-butylphenyl)-11,11-dimethyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaen-15-one (PubChem CID 102143729) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is 14-(4-tert-butylphenyl)-11,11-dimethyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaen-15-one.
| Compound Name | 14-(4-tert-butylphenyl)-11,11-dimethyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaen-15-one |
|---|---|
| PubChem CID | 102143729 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 14-(4-tert-butylphenyl)-11,11-dimethyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaen-15-one |
| SMILES | CC1(C)C=C2c3c(nc4ccccc4c3C(=O)N2c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C26H26N2O/c1-25(2,3)16-10-12-17(13-11-16)28-21-15-26(4,5)14-20-23(21)22(24(28)29)18-8-6-7-9-19(18)27-20/h6-13,15H,14H2,1-5H3 |
| InChIKey | NZTRSWAQGCNFMT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |