C14H24N2O4 — CID 102144318
ethyl 2-[[(2R)-4-methyl-2-(2-methylprop-2-enoylamino)pentanoyl]amino]acetate (PubChem CID 102144318) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is ethyl 2-[[(2R)-4-methyl-2-(2-methylprop-2-enoylamino)pentanoyl]amino]acetate.
| Compound Name | ethyl 2-[[(2R)-4-methyl-2-(2-methylprop-2-enoylamino)pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 102144318 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | ethyl 2-[[(2R)-4-methyl-2-(2-methylprop-2-enoylamino)pentanoyl]amino]acetate |
| SMILES | C=C(C)C(=O)N[C@H](CC(C)C)C(=O)NCC(=O)OCC |
| InChI | InChI=1S/C14H24N2O4/c1-6-20-12(17)8-15-14(19)11(7-9(2)3)16-13(18)10(4)5/h9,11H,4,6-8H2,1-3,5H3,(H,15,19)(H,16,18)/t11-/m1/s1 |
| InChIKey | RSHLACUMHHNONU-LLVKDONJSA-N |
| XLogP | 0.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|