About ethyl 4-aminobenzoate;hydrochloride
ethyl 4-aminobenzoate;hydrochloride (PubChem CID 10214462) has the molecular formula C9H12ClNO2
and a molecular weight of 201.65 g/mol. Its IUPAC name is ethyl 4-aminobenzoate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 4-aminobenzoate;hydrochloride |
| PubChem CID | 10214462 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | ethyl 4-aminobenzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C9H11NO2.ClH/c1-2-12-9(11)7-3-5-8(10)6-4-7;/h3-6H,2,10H2,1H3;1H |
| InChIKey | JAADDQHUJDUAKW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-aminobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-aminobenzoate;hydrochloride?
The IUPAC name of ethyl 4-aminobenzoate;hydrochloride (CID 10214462) is ethyl 4-aminobenzoate;hydrochloride.
What is the SMILES notation for ethyl 4-aminobenzoate;hydrochloride?
The canonical SMILES for ethyl 4-aminobenzoate;hydrochloride is CCOC(=O)c1ccc(N)cc1.Cl.
What is the InChIKey of ethyl 4-aminobenzoate;hydrochloride?
The InChIKey is JAADDQHUJDUAKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.ClH/c1-2-12-9(11)7-3-5-8(10)6-4-7;/h3-6H,2,10H2,1H3;1H.
What are the key properties of ethyl 4-aminobenzoate;hydrochloride?
ethyl 4-aminobenzoate;hydrochloride has a molecular weight of 201.65 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-aminobenzoate;hydrochloride is sourced from PubChem (CID 10214462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).