C14H18O4 — CID 102145220
ethyl (1S,2S,6R,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylate (PubChem CID 102145220) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is ethyl (1S,2S,6R,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylate.
| Compound Name | ethyl (1S,2S,6R,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylate |
|---|---|
| PubChem CID | 102145220 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl (1S,2S,6R,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H]2C=C[C@H]1[C@H]1OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H18O4/c1-4-16-13(15)10-7-8-5-6-9(10)12-11(8)17-14(2,3)18-12/h5-9,11-12H,4H2,1-3H3/t8-,9+,11-,12+/m0/s1 |
| InChIKey | RAMQXAJSJRNAII-BSJXLVFVSA-N |
| XLogP | 1.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|