C31H35BrO3 — CID 102145635
methyl 4-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)benzoate (PubChem CID 102145635) has the molecular formula C31H35BrO3 and a molecular weight of 535.52 g/mol. Its IUPAC name is methyl 4-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)benzoate.
| Compound Name | methyl 4-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)benzoate |
|---|---|
| PubChem CID | 102145635 |
| Molecular Formula | C31H35BrO3 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | methyl 4-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(C(C)(C)C)cc3c2Oc2c(Br)cc(C(C)(C)C)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C31H35BrO3/c1-29(2,3)20-14-22(18-10-12-19(13-11-18)28(33)34-9)26-23(15-20)31(7,8)24-16-21(30(4,5)6)17-25(32)27(24)35-26/h10-17H,1-9H3 |
| InChIKey | NQYDSDAOFZCJFR-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |