C21H20OS16 — CID 102145931
1,3-bis[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanyl]propan-2-ol (PubChem CID 102145931) has the molecular formula C21H20OS16 and a molecular weight of 801.46 g/mol. Its IUPAC name is 1,3-bis[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanyl]propan-2-ol.
| Compound Name | 1,3-bis[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 102145931 |
| Molecular Formula | C21H20OS16 |
| Molecular Weight | 801.46 g/mol |
| Exact Mass | 799.70 |
| IUPAC Name | 1,3-bis[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanyl]propan-2-ol |
| SMILES | CSC1=C(SCC(O)CSC2=C(SC)SC(=C3SC4=C(SCCS4)S3)S2)SC(=C2SC3=C(SCCS3)S2)S1 |
| InChI | InChI=1S/C21H20OS16/c1-23-10-12(33-18(31-10)20-35-14-15(36-20)26-4-3-25-14)29-7-9(22)8-30-13-11(24-2)32-19(34-13)21-37-16-17(38-21)28-6-5-27-16/h9,22H,3-8H2,1-2H3 |
| InChIKey | STTOJKOIEIEJJE-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.46 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |