C7H7F3N2O — CID 102146121
(2S)-1,1,1-trifluoro-3-pyrimidin-4-ylpropan-2-ol (PubChem CID 102146121) has the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-pyrimidin-4-ylpropan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-3-pyrimidin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 102146121 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-pyrimidin-4-ylpropan-2-ol |
| SMILES | O[C@@H](Cc1ccncn1)C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2O/c8-7(9,10)6(13)3-5-1-2-11-4-12-5/h1-2,4,6,13H,3H2/t6-/m0/s1 |
| InChIKey | IKICPWZJUOJRPX-LURJTMIESA-N |
| XLogP | 0.94 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |