C28H34N6O7S3 — CID 102146159
tert-butyl (4S)-4-[4-[(2S,3R)-3-amino-3,6-bis(4-methoxycarbonyl-1,3-thiazol-2-yl)-4,5-dihydro-2H-pyridin-2-yl]-1,3-thiazol-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 102146159) has the molecular formula C28H34N6O7S3 and a molecular weight of 662.82 g/mol. Its IUPAC name is tert-butyl (4S)-4-[4-[(2S,3R)-3-amino-3,6-bis(4-methoxycarbonyl-1,3-thiazol-2-yl)-4,5-dihydro-2H-pyridin-2-yl]-1,3-thiazol-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[4-[(2S,3R)-3-amino-3,6-bis(4-methoxycarbonyl-1,3-thiazol-2-yl)-4,5-dihydro-2H-pyridin-2-yl]-1,3-thiazol-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102146159 |
| Molecular Formula | C28H34N6O7S3 |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.17 |
| IUPAC Name | tert-butyl (4S)-4-[4-[(2S,3R)-3-amino-3,6-bis(4-methoxycarbonyl-1,3-thiazol-2-yl)-4,5-dihydro-2H-pyridin-2-yl]-1,3-thiazol-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(=O)c1csc(C2=N[C@H](c3csc([C@@H]4COC(C)(C)N4C(=O)OC(C)(C)C)n3)[C@@](N)(c3nc(C(=O)OC)cs3)CC2)n1 |
| InChI | InChI=1S/C28H34N6O7S3/c1-26(2,3)41-25(37)34-18(10-40-27(34,4)5)21-31-15(11-43-21)19-28(29,24-33-17(13-44-24)23(36)39-7)9-8-14(30-19)20-32-16(12-42-20)22(35)38-6/h11-13,18-19H,8-10,29H2,1-7H3/t18-,19+,28+/m0/s1 |
| InChIKey | MPFGYKXLTIWKEW-DORSKGMSSA-N |
| XLogP | 4.85 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|