C21H36O4Si — CID 102146553
methyl (E)-4-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-6-[(E)-prop-1-enyl]oxan-2-yl]-3-methylbut-2-enoate (PubChem CID 102146553) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is methyl (E)-4-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-6-[(E)-prop-1-enyl]oxan-2-yl]-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-6-[(E)-prop-1-enyl]oxan-2-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 102146553 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | methyl (E)-4-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-6-[(E)-prop-1-enyl]oxan-2-yl]-3-methylbut-2-enoate |
| SMILES | C=C1C[C@@H](/C=C/C)O[C@@H](C/C(C)=C/C(=O)OC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O4Si/c1-10-11-17-14-16(3)20(25-26(8,9)21(4,5)6)18(24-17)12-15(2)13-19(22)23-7/h10-11,13,17-18,20H,3,12,14H2,1-2,4-9H3/b11-10+,15-13+/t17-,18+,20-/m1/s1 |
| InChIKey | UOONOWWLFTUIIM-AUSLKWQGSA-N |
| XLogP | 5.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|