C21H34O7Si — CID 102146556
methyl (E)-4-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-prop-2-enoxycarbonyloxy-3,6-dihydro-2H-pyran-2-yl]-3-methylbut-2-enoate (PubChem CID 102146556) has the molecular formula C21H34O7Si and a molecular weight of 426.58 g/mol. Its IUPAC name is methyl (E)-4-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-prop-2-enoxycarbonyloxy-3,6-dihydro-2H-pyran-2-yl]-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-prop-2-enoxycarbonyloxy-3,6-dihydro-2H-pyran-2-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 102146556 |
| Molecular Formula | C21H34O7Si |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | methyl (E)-4-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-prop-2-enoxycarbonyloxy-3,6-dihydro-2H-pyran-2-yl]-3-methylbut-2-enoate |
| SMILES | C=CCOC(=O)OC1=CCO[C@@H](C/C(C)=C/C(=O)OC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O7Si/c1-9-11-26-20(23)27-16-10-12-25-17(13-15(2)14-18(22)24-6)19(16)28-29(7,8)21(3,4)5/h9-10,14,17,19H,1,11-13H2,2-8H3/b15-14+/t17-,19+/m0/s1 |
| InChIKey | BPQKTWFBMMUJQX-RDQUZODKSA-N |
| XLogP | 4.51 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|