C15H22N2 — CID 102146713
2,2,4-triethyl-1,3-dihydro-1,5-benzodiazepine (PubChem CID 102146713) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2,2,4-triethyl-1,3-dihydro-1,5-benzodiazepine.
| Compound Name | 2,2,4-triethyl-1,3-dihydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 102146713 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2,2,4-triethyl-1,3-dihydro-1,5-benzodiazepine |
| SMILES | CCC1=Nc2ccccc2NC(CC)(CC)C1 |
| InChI | InChI=1S/C15H22N2/c1-4-12-11-15(5-2,6-3)17-14-10-8-7-9-13(14)16-12/h7-10,17H,4-6,11H2,1-3H3 |
| InChIKey | PGWKHUZUEYDOEL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |