C15H30OSi — CID 102147070
tert-butyl-[(E)-3-cyclohexylprop-2-enoxy]-dimethylsilane (PubChem CID 102147070) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is tert-butyl-[(E)-3-cyclohexylprop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-3-cyclohexylprop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102147070 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | tert-butyl-[(E)-3-cyclohexylprop-2-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/C1CCCCC1 |
| InChI | InChI=1S/C15H30OSi/c1-15(2,3)17(4,5)16-13-9-12-14-10-7-6-8-11-14/h9,12,14H,6-8,10-11,13H2,1-5H3/b12-9+ |
| InChIKey | AYCIXKYUHFECBY-FMIVXFBMSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|