About (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one
(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one (PubChem CID 102147264) has the molecular formula C21H25NO2Si
and a molecular weight of 351.52 g/mol. Its IUPAC name is (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one |
| PubChem CID | 102147264 |
| Molecular Formula | C21H25NO2Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1C=CC(=O)N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2Si/c1-21(2,3)25(18-10-6-4-7-11-18,19-12-8-5-9-13-19)24-16-17-14-15-20(23)22-17/h4-15,17H,16H2,1-3H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | FSNNHAXDIKBYAY-QGZVFWFLSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one?
The IUPAC name of (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one (CID 102147264) is (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one.
What is the SMILES notation for (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one?
The canonical SMILES for (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one is CC(C)(C)[Si](OC[C@H]1C=CC(=O)N1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one?
The InChIKey is FSNNHAXDIKBYAY-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H25NO2Si/c1-21(2,3)25(18-10-6-4-7-11-18,19-12-8-5-9-13-19)24-16-17-14-15-20(23)22-17/h4-15,17H,16H2,1-3H3,(H,22,23)/t17-/m1/s1.
What are the key properties of (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one?
(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one has a molecular weight of 351.52 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 102147264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).