5,6-diphenylpyrazine-2-carboxylic acid

C17H12N2O2 — CID 10214728

IUPAC5,6-diphenylpyrazine-2-carboxylic acid
SMILESO=C(O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1
InChIInChI=1S/C17H12N2O2/c20-17(21)14-11-18-15(12-7-3-1-4-8-12)16(19-14)13-9-5-2-6-10-13/h1-11H,(H,20,21)
InChIKeyJSXUTJNCMVFTEN-UHFFFAOYSA-N
MW276.30 g/mol
LogP3.51
Rot. Bonds3

About 5,6-diphenylpyrazine-2-carboxylic acid

5,6-diphenylpyrazine-2-carboxylic acid (PubChem CID 10214728) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 5,6-diphenylpyrazine-2-carboxylic acid.

Molecular Properties

Compound Name5,6-diphenylpyrazine-2-carboxylic acid
PubChem CID10214728
Molecular FormulaC17H12N2O2
Molecular Weight276.30 g/mol
Exact Mass276.09
IUPAC Name5,6-diphenylpyrazine-2-carboxylic acid
SMILESO=C(O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1
InChIInChI=1S/C17H12N2O2/c20-17(21)14-11-18-15(12-7-3-1-4-8-12)16(19-14)13-9-5-2-6-10-13/h1-11H,(H,20,21)
InChIKeyJSXUTJNCMVFTEN-UHFFFAOYSA-N
XLogP3.51
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.30
LogP ≤ 53.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5,6-diphenylpyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-diphenylpyrazine-2-carboxylic acid?
The IUPAC name of 5,6-diphenylpyrazine-2-carboxylic acid (CID 10214728) is 5,6-diphenylpyrazine-2-carboxylic acid.
What is the SMILES notation for 5,6-diphenylpyrazine-2-carboxylic acid?
The canonical SMILES for 5,6-diphenylpyrazine-2-carboxylic acid is O=C(O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of 5,6-diphenylpyrazine-2-carboxylic acid?
The InChIKey is JSXUTJNCMVFTEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2/c20-17(21)14-11-18-15(12-7-3-1-4-8-12)16(19-14)13-9-5-2-6-10-13/h1-11H,(H,20,21).
What are the key properties of 5,6-diphenylpyrazine-2-carboxylic acid?
5,6-diphenylpyrazine-2-carboxylic acid has a molecular weight of 276.30 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diphenylpyrazine-2-carboxylic acid is sourced from PubChem (CID 10214728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).