C29H32N2O3 — CID 102147389
tert-butyl (2S,3R)-1-benzhydryl-3-[[(1S)-1-phenylethyl]carbamoyl]aziridine-2-carboxylate (PubChem CID 102147389) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is tert-butyl (2S,3R)-1-benzhydryl-3-[[(1S)-1-phenylethyl]carbamoyl]aziridine-2-carboxylate.
| Compound Name | tert-butyl (2S,3R)-1-benzhydryl-3-[[(1S)-1-phenylethyl]carbamoyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 102147389 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | tert-butyl (2S,3R)-1-benzhydryl-3-[[(1S)-1-phenylethyl]carbamoyl]aziridine-2-carboxylate |
| SMILES | C[C@H](NC(=O)[C@H]1[C@@H](C(=O)OC(C)(C)C)N1C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32N2O3/c1-20(21-14-8-5-9-15-21)30-27(32)25-26(28(33)34-29(2,3)4)31(25)24(22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20,24-26H,1-4H3,(H,30,32)/t20-,25+,26-,31?/m0/s1 |
| InChIKey | BZIPFFPONYQWBE-QPHJQQIXSA-N |
| XLogP | 5.05 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|