C45H83BS2Si8 — CID 102147546
1,3,2-benzodithiaborol-2-yl-(2,4,6-trimethylphenyl)-trimethylsilyl-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]silane (PubChem CID 102147546) has the molecular formula C45H83BS2Si8 and a molecular weight of 923.79 g/mol. Its IUPAC name is 1,3,2-benzodithiaborol-2-yl-(2,4,6-trimethylphenyl)-trimethylsilyl-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]silane.
| Compound Name | 1,3,2-benzodithiaborol-2-yl-(2,4,6-trimethylphenyl)-trimethylsilyl-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]silane |
|---|---|
| PubChem CID | 102147546 |
| Molecular Formula | C45H83BS2Si8 |
| Molecular Weight | 923.79 g/mol |
| Exact Mass | 922.42 |
| IUPAC Name | 1,3,2-benzodithiaborol-2-yl-(2,4,6-trimethylphenyl)-trimethylsilyl-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]silane |
| SMILES | Cc1cc(C)c([Si](B2Sc3ccccc3S2)(c2c(C([Si](C)(C)C)[Si](C)(C)C)cc(C([Si](C)(C)C)[Si](C)(C)C)cc2C([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C45H83BS2Si8/c1-33-29-34(2)41(35(3)30-33)56(55(22,23)24,46-47-39-27-25-26-28-40(39)48-46)42-37(44(51(10,11)12)52(13,14)15)31-36(43(49(4,5)6)50(7,8)9)32-38(42)45(53(16,17)18)54(19,20)21/h25-32,43-45H,1-24H3 |
| InChIKey | SDQWJWMBDMBZTD-UHFFFAOYSA-N |
| XLogP | 14.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.79 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|