About (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione
(4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione (PubChem CID 102147730) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione.
Molecular Properties
| Compound Name | (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione |
| PubChem CID | 102147730 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione |
| SMILES | CC[C@]12C=CC(=O)C=C1OCC(=O)O2 |
| InChI | InChI=1S/C10H10O4/c1-2-10-4-3-7(11)5-8(10)13-6-9(12)14-10/h3-5H,2,6H2,1H3/t10-/m0/s1 |
| InChIKey | GMBNIHQIWXRVFA-JTQLQIEISA-N |
| XLogP | 0.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione?
The IUPAC name of (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione (CID 102147730) is (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione.
What is the SMILES notation for (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione?
The canonical SMILES for (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione is CC[C@]12C=CC(=O)C=C1OCC(=O)O2.
What is the InChIKey of (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione?
The InChIKey is GMBNIHQIWXRVFA-JTQLQIEISA-N. The full InChI is InChI=1S/C10H10O4/c1-2-10-4-3-7(11)5-8(10)13-6-9(12)14-10/h3-5H,2,6H2,1H3/t10-/m0/s1.
What are the key properties of (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione?
(4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione has a molecular weight of 194.19 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4aS)-4a-ethyl-1,4-benzodioxine-3,7-dione is sourced from PubChem (CID 102147730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).