C48H57NO4Si — CID 102147835
2-[(2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-7-methyl-3-trityloxyoct-7-en-2-yl]oxy-N,N-dimethylacetamide (PubChem CID 102147835) has the molecular formula C48H57NO4Si and a molecular weight of 740.07 g/mol. Its IUPAC name is 2-[(2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-7-methyl-3-trityloxyoct-7-en-2-yl]oxy-N,N-dimethylacetamide.
| Compound Name | 2-[(2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-7-methyl-3-trityloxyoct-7-en-2-yl]oxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 102147835 |
| Molecular Formula | C48H57NO4Si |
| Molecular Weight | 740.07 g/mol |
| Exact Mass | 739.41 |
| IUPAC Name | 2-[(2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-7-methyl-3-trityloxyoct-7-en-2-yl]oxy-N,N-dimethylacetamide |
| SMILES | C=C(C)CCC[C@@H](OC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCC(=O)N(C)C |
| InChI | InChI=1S/C48H57NO4Si/c1-38(2)24-23-35-44(53-48(39-25-13-8-14-26-39,40-27-15-9-16-28-40)41-29-17-10-18-30-41)45(51-37-46(50)49(6)7)36-52-54(47(3,4)5,42-31-19-11-20-32-42)43-33-21-12-22-34-43/h8-22,25-34,44-45H,1,23-24,35-37H2,2-7H3/t44-,45-/m1/s1 |
| InChIKey | SZLDUDIGHVHLPD-GSFSDPDBSA-N |
| XLogP | 9.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.07 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|