C48H56ClNO4Si — CID 102147836
2-[(E,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-7-methyl-3-trityloxyoct-7-en-2-yl]oxy-N,N-dimethylacetamide (PubChem CID 102147836) has the molecular formula C48H56ClNO4Si and a molecular weight of 774.52 g/mol. Its IUPAC name is 2-[(E,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-7-methyl-3-trityloxyoct-7-en-2-yl]oxy-N,N-dimethylacetamide.
| Compound Name | 2-[(E,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-7-methyl-3-trityloxyoct-7-en-2-yl]oxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 102147836 |
| Molecular Formula | C48H56ClNO4Si |
| Molecular Weight | 774.52 g/mol |
| Exact Mass | 773.37 |
| IUPAC Name | 2-[(E,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-7-methyl-3-trityloxyoct-7-en-2-yl]oxy-N,N-dimethylacetamide |
| SMILES | C/C(=C\Cl)CCC[C@@H](OC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCC(=O)N(C)C |
| InChI | InChI=1S/C48H56ClNO4Si/c1-38(35-49)23-22-34-44(54-48(39-24-12-7-13-25-39,40-26-14-8-15-27-40)41-28-16-9-17-29-41)45(52-37-46(51)50(5)6)36-53-55(47(2,3)4,42-30-18-10-19-31-42)43-32-20-11-21-33-43/h7-21,24-33,35,44-45H,22-23,34,36-37H2,1-6H3/b38-35+/t44-,45-/m1/s1 |
| InChIKey | FKGHMPOGJYFKNC-JBQGRCDWSA-N |
| XLogP | 9.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.52 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|