C27H35NO4 — CID 102147839
(2R,3R,6Z,9R)-N,N,7-trimethyl-3-phenylmethoxy-2-(phenylmethoxymethyl)-2,3,4,5,8,9-hexahydrooxonine-9-carboxamide (PubChem CID 102147839) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is (2R,3R,6Z,9R)-N,N,7-trimethyl-3-phenylmethoxy-2-(phenylmethoxymethyl)-2,3,4,5,8,9-hexahydrooxonine-9-carboxamide.
| Compound Name | (2R,3R,6Z,9R)-N,N,7-trimethyl-3-phenylmethoxy-2-(phenylmethoxymethyl)-2,3,4,5,8,9-hexahydrooxonine-9-carboxamide |
|---|---|
| PubChem CID | 102147839 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (2R,3R,6Z,9R)-N,N,7-trimethyl-3-phenylmethoxy-2-(phenylmethoxymethyl)-2,3,4,5,8,9-hexahydrooxonine-9-carboxamide |
| SMILES | C/C1=C/CC[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H](C(=O)N(C)C)C1 |
| InChI | InChI=1S/C27H35NO4/c1-21-11-10-16-24(31-19-23-14-8-5-9-15-23)26(32-25(17-21)27(29)28(2)3)20-30-18-22-12-6-4-7-13-22/h4-9,11-15,24-26H,10,16-20H2,1-3H3/b21-11-/t24-,25-,26-/m1/s1 |
| InChIKey | KPFLUSPHYSUDCY-BKIFEBSHSA-N |
| XLogP | 4.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|