C12H16Cl2N2O2 — CID 102148640
2,5-dichloro-3-(diethylamino)-6-(ethylamino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 102148640) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 2,5-dichloro-3-(diethylamino)-6-(ethylamino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dichloro-3-(diethylamino)-6-(ethylamino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 102148640 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2,5-dichloro-3-(diethylamino)-6-(ethylamino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCNC1=C(Cl)C(=O)C(N(CC)CC)=C(Cl)C1=O |
| InChI | InChI=1S/C12H16Cl2N2O2/c1-4-15-9-7(13)12(18)10(8(14)11(9)17)16(5-2)6-3/h15H,4-6H2,1-3H3 |
| InChIKey | KRXIQRFPIFJPNH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|