About O-nonyl butylsulfanylmethanethioate
O-nonyl butylsulfanylmethanethioate (PubChem CID 102149031) has the molecular formula C14H28OS2
and a molecular weight of 276.51 g/mol. Its IUPAC name is O-nonyl butylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-nonyl butylsulfanylmethanethioate |
| PubChem CID | 102149031 |
| Molecular Formula | C14H28OS2 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | O-nonyl butylsulfanylmethanethioate |
| SMILES | CCCCCCCCCOC(=S)SCCCC |
| InChI | InChI=1S/C14H28OS2/c1-3-5-7-8-9-10-11-12-15-14(16)17-13-6-4-2/h3-13H2,1-2H3 |
| InChIKey | XKEOSGVYTHSUMJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-nonyl butylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-nonyl butylsulfanylmethanethioate?
The IUPAC name of O-nonyl butylsulfanylmethanethioate (CID 102149031) is O-nonyl butylsulfanylmethanethioate.
What is the SMILES notation for O-nonyl butylsulfanylmethanethioate?
The canonical SMILES for O-nonyl butylsulfanylmethanethioate is CCCCCCCCCOC(=S)SCCCC.
What is the InChIKey of O-nonyl butylsulfanylmethanethioate?
The InChIKey is XKEOSGVYTHSUMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28OS2/c1-3-5-7-8-9-10-11-12-15-14(16)17-13-6-4-2/h3-13H2,1-2H3.
What are the key properties of O-nonyl butylsulfanylmethanethioate?
O-nonyl butylsulfanylmethanethioate has a molecular weight of 276.51 g/mol, XLogP of 5.57, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-nonyl butylsulfanylmethanethioate is sourced from PubChem (CID 102149031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).